C13H18Cl2N2O3S — CID 65388491
2,3-dichloro-N-methyl-N-(2-methylbutan-2-yl)-5-sulfamoylbenzamide (PubChem CID 65388491) has the molecular formula C13H18Cl2N2O3S and a molecular weight of 353.27 g/mol. Its IUPAC name is 2,3-dichloro-N-methyl-N-(2-methylbutan-2-yl)-5-sulfamoylbenzamide.
| Compound Name | 2,3-dichloro-N-methyl-N-(2-methylbutan-2-yl)-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 65388491 |
| Molecular Formula | C13H18Cl2N2O3S |
| Molecular Weight | 353.27 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | 2,3-dichloro-N-methyl-N-(2-methylbutan-2-yl)-5-sulfamoylbenzamide |
| SMILES | CCC(C)(C)N(C)C(=O)c1cc(S(N)(=O)=O)cc(Cl)c1Cl |
| InChI | InChI=1S/C13H18Cl2N2O3S/c1-5-13(2,3)17(4)12(18)9-6-8(21(16,19)20)7-10(14)11(9)15/h6-7H,5H2,1-4H3,(H2,16,19,20) |
| InChIKey | VEWJJBOOECLGFE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.27 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |