C9H8Cl3NO3S — CID 65371801
3,4-dichloro-5-(dimethylcarbamoyl)benzenesulfonyl chloride (PubChem CID 65371801) has the molecular formula C9H8Cl3NO3S and a molecular weight of 316.59 g/mol. Its IUPAC name is 3,4-dichloro-5-(dimethylcarbamoyl)benzenesulfonyl chloride.
| Compound Name | 3,4-dichloro-5-(dimethylcarbamoyl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 65371801 |
| Molecular Formula | C9H8Cl3NO3S |
| Molecular Weight | 316.59 g/mol |
| Exact Mass | 314.93 |
| IUPAC Name | 3,4-dichloro-5-(dimethylcarbamoyl)benzenesulfonyl chloride |
| SMILES | CN(C)C(=O)c1cc(S(=O)(=O)Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C9H8Cl3NO3S/c1-13(2)9(14)6-3-5(17(12,15)16)4-7(10)8(6)11/h3-4H,1-2H3 |
| InChIKey | WUVSMKLLFGTZIM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.59 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |