C15H22ClNO3S — CID 43103561
3,5-diethyl-4-(pentanoylamino)benzenesulfonyl chloride (PubChem CID 43103561) has the molecular formula C15H22ClNO3S and a molecular weight of 331.87 g/mol. Its IUPAC name is 3,5-diethyl-4-(pentanoylamino)benzenesulfonyl chloride.
| Compound Name | 3,5-diethyl-4-(pentanoylamino)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 43103561 |
| Molecular Formula | C15H22ClNO3S |
| Molecular Weight | 331.87 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 3,5-diethyl-4-(pentanoylamino)benzenesulfonyl chloride |
| SMILES | CCCCC(=O)Nc1c(CC)cc(S(=O)(=O)Cl)cc1CC |
| InChI | InChI=1S/C15H22ClNO3S/c1-4-7-8-14(18)17-15-11(5-2)9-13(21(16,19)20)10-12(15)6-3/h9-10H,4-8H2,1-3H3,(H,17,18) |
| InChIKey | DKDDRYZZVRSRDZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.87 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |