N-pentanoylsulfamoyl chloride

C5H10ClNO3S — CID 59773977

IUPACN-pentanoylsulfamoyl chloride
SMILESCCCCC(=O)NS(=O)(=O)Cl
InChIInChI=1S/C5H10ClNO3S/c1-2-3-4-5(8)7-11(6,9)10/h2-4H2,1H3,(H,7,8)
InChIKeyNYIOLFDZEXBNLH-UHFFFAOYSA-N
MW199.66 g/mol
LogP0.78
Rot. Bonds4

About N-pentanoylsulfamoyl chloride

N-pentanoylsulfamoyl chloride (PubChem CID 59773977) has the molecular formula C5H10ClNO3S and a molecular weight of 199.66 g/mol. Its IUPAC name is N-pentanoylsulfamoyl chloride.

Molecular Properties

Compound NameN-pentanoylsulfamoyl chloride
PubChem CID59773977
Molecular FormulaC5H10ClNO3S
Molecular Weight199.66 g/mol
Exact Mass199.01
IUPAC NameN-pentanoylsulfamoyl chloride
SMILESCCCCC(=O)NS(=O)(=O)Cl
InChIInChI=1S/C5H10ClNO3S/c1-2-3-4-5(8)7-11(6,9)10/h2-4H2,1H3,(H,7,8)
InChIKeyNYIOLFDZEXBNLH-UHFFFAOYSA-N
XLogP0.78
TPSA63.24 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.66
LogP ≤ 50.78
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze N-pentanoylsulfamoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-pentanoylsulfamoyl chloride?
The IUPAC name of N-pentanoylsulfamoyl chloride (CID 59773977) is N-pentanoylsulfamoyl chloride.
What is the SMILES notation for N-pentanoylsulfamoyl chloride?
The canonical SMILES for N-pentanoylsulfamoyl chloride is CCCCC(=O)NS(=O)(=O)Cl.
What is the InChIKey of N-pentanoylsulfamoyl chloride?
The InChIKey is NYIOLFDZEXBNLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10ClNO3S/c1-2-3-4-5(8)7-11(6,9)10/h2-4H2,1H3,(H,7,8).
What are the key properties of N-pentanoylsulfamoyl chloride?
N-pentanoylsulfamoyl chloride has a molecular weight of 199.66 g/mol, XLogP of 0.78, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-pentanoylsulfamoyl chloride is sourced from PubChem (CID 59773977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).