C17H20Cl3NO3 — CID 88840150
(2E)-2-[[3-(butanoylamino)-2,4,6-trichlorophenyl]methylidene]hexanoic acid (PubChem CID 88840150) has the molecular formula C17H20Cl3NO3 and a molecular weight of 392.71 g/mol. Its IUPAC name is (2E)-2-[[3-(butanoylamino)-2,4,6-trichlorophenyl]methylidene]hexanoic acid.
| Compound Name | (2E)-2-[[3-(butanoylamino)-2,4,6-trichlorophenyl]methylidene]hexanoic acid |
|---|---|
| PubChem CID | 88840150 |
| Molecular Formula | C17H20Cl3NO3 |
| Molecular Weight | 392.71 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | (2E)-2-[[3-(butanoylamino)-2,4,6-trichlorophenyl]methylidene]hexanoic acid |
| SMILES | CCCC/C(=C\c1c(Cl)cc(Cl)c(NC(=O)CCC)c1Cl)C(=O)O |
| InChI | InChI=1S/C17H20Cl3NO3/c1-3-5-7-10(17(23)24)8-11-12(18)9-13(19)16(15(11)20)21-14(22)6-4-2/h8-9H,3-7H2,1-2H3,(H,21,22)(H,23,24)/b10-8+ |
| InChIKey | WEXQBMMCDZYTRL-CSKARUKUSA-N |
| XLogP | 6.04 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.71 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|