C9H4Br2ClFN2O — CID 168521788
2-cyano-N-(2,4-dibromo-6-chloro-3-fluorophenyl)acetamide (PubChem CID 168521788) has the molecular formula C9H4Br2ClFN2O and a molecular weight of 370.40 g/mol. Its IUPAC name is 2-cyano-N-(2,4-dibromo-6-chloro-3-fluorophenyl)acetamide.
| Compound Name | 2-cyano-N-(2,4-dibromo-6-chloro-3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 168521788 |
| Molecular Formula | C9H4Br2ClFN2O |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 367.84 |
| IUPAC Name | 2-cyano-N-(2,4-dibromo-6-chloro-3-fluorophenyl)acetamide |
| SMILES | N#CCC(=O)Nc1c(Cl)cc(Br)c(F)c1Br |
| InChI | InChI=1S/C9H4Br2ClFN2O/c10-4-3-5(12)9(7(11)8(4)13)15-6(16)1-2-14/h3H,1H2,(H,15,16) |
| InChIKey | NAUUEPDPEAWPFH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|