C9H4BrCl2FN2O — CID 168521570
N-(6-bromo-3,4-dichloro-2-fluorophenyl)-2-cyanoacetamide (PubChem CID 168521570) has the molecular formula C9H4BrCl2FN2O and a molecular weight of 325.95 g/mol. Its IUPAC name is N-(6-bromo-3,4-dichloro-2-fluorophenyl)-2-cyanoacetamide.
| Compound Name | N-(6-bromo-3,4-dichloro-2-fluorophenyl)-2-cyanoacetamide |
|---|---|
| PubChem CID | 168521570 |
| Molecular Formula | C9H4BrCl2FN2O |
| Molecular Weight | 325.95 g/mol |
| Exact Mass | 323.89 |
| IUPAC Name | N-(6-bromo-3,4-dichloro-2-fluorophenyl)-2-cyanoacetamide |
| SMILES | N#CCC(=O)Nc1c(Br)cc(Cl)c(Cl)c1F |
| InChI | InChI=1S/C9H4BrCl2FN2O/c10-4-3-5(11)7(12)8(13)9(4)15-6(16)1-2-14/h3H,1H2,(H,15,16) |
| InChIKey | JGNOWOIQCZYDBV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.95 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|