C11H11ClN2O — CID 168523333
N-(4-chloro-3,5-dimethylphenyl)-2-cyanoacetamide (PubChem CID 168523333) has the molecular formula C11H11ClN2O and a molecular weight of 222.67 g/mol. Its IUPAC name is N-(4-chloro-3,5-dimethylphenyl)-2-cyanoacetamide.
| Compound Name | N-(4-chloro-3,5-dimethylphenyl)-2-cyanoacetamide |
|---|---|
| PubChem CID | 168523333 |
| Molecular Formula | C11H11ClN2O |
| Molecular Weight | 222.67 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | N-(4-chloro-3,5-dimethylphenyl)-2-cyanoacetamide |
| SMILES | Cc1cc(NC(=O)CC#N)cc(C)c1Cl |
| InChI | InChI=1S/C11H11ClN2O/c1-7-5-9(6-8(2)11(7)12)14-10(15)3-4-13/h5-6H,3H2,1-2H3,(H,14,15) |
| InChIKey | GDFVAJSUQLSOJD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.67 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |