C10H5Cl2F3N2O — CID 168521011
2-cyano-N-[2,6-dichloro-3-(trifluoromethyl)phenyl]acetamide (PubChem CID 168521011) has the molecular formula C10H5Cl2F3N2O and a molecular weight of 297.06 g/mol. Its IUPAC name is 2-cyano-N-[2,6-dichloro-3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-cyano-N-[2,6-dichloro-3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 168521011 |
| Molecular Formula | C10H5Cl2F3N2O |
| Molecular Weight | 297.06 g/mol |
| Exact Mass | 295.97 |
| IUPAC Name | 2-cyano-N-[2,6-dichloro-3-(trifluoromethyl)phenyl]acetamide |
| SMILES | N#CCC(=O)Nc1c(Cl)ccc(C(F)(F)F)c1Cl |
| InChI | InChI=1S/C10H5Cl2F3N2O/c11-6-2-1-5(10(13,14)15)8(12)9(6)17-7(18)3-4-16/h1-2H,3H2,(H,17,18) |
| InChIKey | HAVMCCAASWBOBJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.06 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |