C10H12ClNO2 — CID 81481829
7-chloro-N-methoxy-3,4-dihydro-2H-chromen-4-amine (PubChem CID 81481829) has the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. Its IUPAC name is 7-chloro-N-methoxy-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | 7-chloro-N-methoxy-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 81481829 |
| Molecular Formula | C10H12ClNO2 |
| Molecular Weight | 213.66 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 7-chloro-N-methoxy-3,4-dihydro-2H-chromen-4-amine |
| SMILES | CONC1CCOc2cc(Cl)ccc21 |
| InChI | InChI=1S/C10H12ClNO2/c1-13-12-9-4-5-14-10-6-7(11)2-3-8(9)10/h2-3,6,9,12H,4-5H2,1H3 |
| InChIKey | MJLCHVFWKWXVIG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.66 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|