C11H14FNO2 — CID 81482118
8-fluoro-N-methoxy-2,3,4,5-tetrahydro-1-benzoxepin-5-amine (PubChem CID 81482118) has the molecular formula C11H14FNO2 and a molecular weight of 211.24 g/mol. Its IUPAC name is 8-fluoro-N-methoxy-2,3,4,5-tetrahydro-1-benzoxepin-5-amine.
| Compound Name | 8-fluoro-N-methoxy-2,3,4,5-tetrahydro-1-benzoxepin-5-amine |
|---|---|
| PubChem CID | 81482118 |
| Molecular Formula | C11H14FNO2 |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 8-fluoro-N-methoxy-2,3,4,5-tetrahydro-1-benzoxepin-5-amine |
| SMILES | CONC1CCCOc2cc(F)ccc21 |
| InChI | InChI=1S/C11H14FNO2/c1-14-13-10-3-2-6-15-11-7-8(12)4-5-9(10)11/h4-5,7,10,13H,2-3,6H2,1H3 |
| InChIKey | ZKZJGPUFNJFJII-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|