C17H27NO2 — CID 81482096
6-tert-butyl-N-methoxy-2,2,8-trimethyl-3,4-dihydrochromen-4-amine (PubChem CID 81482096) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is 6-tert-butyl-N-methoxy-2,2,8-trimethyl-3,4-dihydrochromen-4-amine.
| Compound Name | 6-tert-butyl-N-methoxy-2,2,8-trimethyl-3,4-dihydrochromen-4-amine |
|---|---|
| PubChem CID | 81482096 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | 6-tert-butyl-N-methoxy-2,2,8-trimethyl-3,4-dihydrochromen-4-amine |
| SMILES | CONC1CC(C)(C)Oc2c(C)cc(C(C)(C)C)cc21 |
| InChI | InChI=1S/C17H27NO2/c1-11-8-12(16(2,3)4)9-13-14(18-19-7)10-17(5,6)20-15(11)13/h8-9,14,18H,10H2,1-7H3 |
| InChIKey | RGWHGMIDNLAFGY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|