C14H19NO3 — CID 81480136
N-methoxy-2,2-dimethyl-3,6,7,8-tetrahydrofuro[3,2-h]chromen-6-amine (PubChem CID 81480136) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is N-methoxy-2,2-dimethyl-3,6,7,8-tetrahydrofuro[3,2-h]chromen-6-amine.
| Compound Name | N-methoxy-2,2-dimethyl-3,6,7,8-tetrahydrofuro[3,2-h]chromen-6-amine |
|---|---|
| PubChem CID | 81480136 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | N-methoxy-2,2-dimethyl-3,6,7,8-tetrahydrofuro[3,2-h]chromen-6-amine |
| SMILES | CONC1CCOc2c1ccc1c2OC(C)(C)C1 |
| InChI | InChI=1S/C14H19NO3/c1-14(2)8-9-4-5-10-11(15-16-3)6-7-17-13(10)12(9)18-14/h4-5,11,15H,6-8H2,1-3H3 |
| InChIKey | MPMCAUWXKCBGOI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|