C15H18O3 — CID 83049104
2,2-dimethyl-7-propyl-3H-furo[3,2-g][1]benzofuran-6-one (PubChem CID 83049104) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is 2,2-dimethyl-7-propyl-3H-furo[3,2-g][1]benzofuran-6-one.
| Compound Name | 2,2-dimethyl-7-propyl-3H-furo[3,2-g][1]benzofuran-6-one |
|---|---|
| PubChem CID | 83049104 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 2,2-dimethyl-7-propyl-3H-furo[3,2-g][1]benzofuran-6-one |
| SMILES | CCCC1Oc2c(ccc3c2OC(C)(C)C3)C1=O |
| InChI | InChI=1S/C15H18O3/c1-4-5-11-12(16)10-7-6-9-8-15(2,3)18-13(9)14(10)17-11/h6-7,11H,4-5,8H2,1-3H3 |
| InChIKey | WIENINDRUPSQQF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |