About 6-[2-(6-tert-butyl-2,2-dimethyl-3H-1-benzofuran-7-yl)ethyl]-4-hydroxyoxan-2-one
6-[2-(6-tert-butyl-2,2-dimethyl-3H-1-benzofuran-7-yl)ethyl]-4-hydroxyoxan-2-one (PubChem CID 19781071) has the molecular formula C21H30O4
and a molecular weight of 346.47 g/mol. Its IUPAC name is 6-[2-(6-tert-butyl-2,2-dimethyl-3H-1-benzofuran-7-yl)ethyl]-4-hydroxyoxan-2-one.
Molecular Properties
| Compound Name | 6-[2-(6-tert-butyl-2,2-dimethyl-3H-1-benzofuran-7-yl)ethyl]-4-hydroxyoxan-2-one |
| PubChem CID | 19781071 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 6-[2-(6-tert-butyl-2,2-dimethyl-3H-1-benzofuran-7-yl)ethyl]-4-hydroxyoxan-2-one |
| SMILES | CC1(C)Cc2ccc(C(C)(C)C)c(CCC3CC(O)CC(=O)O3)c2O1 |
| InChI | InChI=1S/C21H30O4/c1-20(2,3)17-9-6-13-12-21(4,5)25-19(13)16(17)8-7-15-10-14(22)11-18(23)24-15/h6,9,14-15,22H,7-8,10-12H2,1-5H3 |
| InChIKey | ACZORLYKQGQOLP-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[2-(6-tert-butyl-2,2-dimethyl-3H-1-benzofuran-7-yl)ethyl]-4-hydroxyoxan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-(6-tert-butyl-2,2-dimethyl-3H-1-benzofuran-7-yl)ethyl]-4-hydroxyoxan-2-one?
The IUPAC name of 6-[2-(6-tert-butyl-2,2-dimethyl-3H-1-benzofuran-7-yl)ethyl]-4-hydroxyoxan-2-one (CID 19781071) is 6-[2-(6-tert-butyl-2,2-dimethyl-3H-1-benzofuran-7-yl)ethyl]-4-hydroxyoxan-2-one.
What is the SMILES notation for 6-[2-(6-tert-butyl-2,2-dimethyl-3H-1-benzofuran-7-yl)ethyl]-4-hydroxyoxan-2-one?
The canonical SMILES for 6-[2-(6-tert-butyl-2,2-dimethyl-3H-1-benzofuran-7-yl)ethyl]-4-hydroxyoxan-2-one is CC1(C)Cc2ccc(C(C)(C)C)c(CCC3CC(O)CC(=O)O3)c2O1.
What is the InChIKey of 6-[2-(6-tert-butyl-2,2-dimethyl-3H-1-benzofuran-7-yl)ethyl]-4-hydroxyoxan-2-one?
The InChIKey is ACZORLYKQGQOLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H30O4/c1-20(2,3)17-9-6-13-12-21(4,5)25-19(13)16(17)8-7-15-10-14(22)11-18(23)24-15/h6,9,14-15,22H,7-8,10-12H2,1-5H3.
What are the key properties of 6-[2-(6-tert-butyl-2,2-dimethyl-3H-1-benzofuran-7-yl)ethyl]-4-hydroxyoxan-2-one?
6-[2-(6-tert-butyl-2,2-dimethyl-3H-1-benzofuran-7-yl)ethyl]-4-hydroxyoxan-2-one has a molecular weight of 346.47 g/mol, XLogP of 3.70, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-(6-tert-butyl-2,2-dimethyl-3H-1-benzofuran-7-yl)ethyl]-4-hydroxyoxan-2-one is sourced from PubChem (CID 19781071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).