C13H14Cl2O3 — CID 67708270
(4S,6S)-6-[2-(2,4-dichlorophenyl)ethyl]-4-hydroxyoxan-2-one (PubChem CID 67708270) has the molecular formula C13H14Cl2O3 and a molecular weight of 289.16 g/mol. Its IUPAC name is (4S,6S)-6-[2-(2,4-dichlorophenyl)ethyl]-4-hydroxyoxan-2-one.
| Compound Name | (4S,6S)-6-[2-(2,4-dichlorophenyl)ethyl]-4-hydroxyoxan-2-one |
|---|---|
| PubChem CID | 67708270 |
| Molecular Formula | C13H14Cl2O3 |
| Molecular Weight | 289.16 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | (4S,6S)-6-[2-(2,4-dichlorophenyl)ethyl]-4-hydroxyoxan-2-one |
| SMILES | O=C1C[C@@H](O)C[C@H](CCc2ccc(Cl)cc2Cl)O1 |
| InChI | InChI=1S/C13H14Cl2O3/c14-9-3-1-8(12(15)5-9)2-4-11-6-10(16)7-13(17)18-11/h1,3,5,10-11,16H,2,4,6-7H2/t10-,11-/m0/s1 |
| InChIKey | CEXNFLNQAGNWPV-QWRGUYRKSA-N |
| XLogP | 2.99 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.16 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |