C18H15Cl3N2O2 — CID 2961815
1-(4-chlorophenyl)-3-[2-(2,4-dichlorophenyl)ethylamino]pyrrolidine-2,5-dione (PubChem CID 2961815) has the molecular formula C18H15Cl3N2O2 and a molecular weight of 397.69 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[2-(2,4-dichlorophenyl)ethylamino]pyrrolidine-2,5-dione.
| Compound Name | 1-(4-chlorophenyl)-3-[2-(2,4-dichlorophenyl)ethylamino]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 2961815 |
| Molecular Formula | C18H15Cl3N2O2 |
| Molecular Weight | 397.69 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[2-(2,4-dichlorophenyl)ethylamino]pyrrolidine-2,5-dione |
| SMILES | O=C1CC(NCCc2ccc(Cl)cc2Cl)C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H15Cl3N2O2/c19-12-3-5-14(6-4-12)23-17(24)10-16(18(23)25)22-8-7-11-1-2-13(20)9-15(11)21/h1-6,9,16,22H,7-8,10H2 |
| InChIKey | CYMZJEOOLQKUED-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.69 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|