C12H15Cl2NO — CID 66005122
3-[[(2,4-dichlorophenyl)methylamino]methyl]cyclobutan-1-ol (PubChem CID 66005122) has the molecular formula C12H15Cl2NO and a molecular weight of 260.16 g/mol. Its IUPAC name is 3-[[(2,4-dichlorophenyl)methylamino]methyl]cyclobutan-1-ol.
| Compound Name | 3-[[(2,4-dichlorophenyl)methylamino]methyl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 66005122 |
| Molecular Formula | C12H15Cl2NO |
| Molecular Weight | 260.16 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 3-[[(2,4-dichlorophenyl)methylamino]methyl]cyclobutan-1-ol |
| SMILES | OC1CC(CNCc2ccc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C12H15Cl2NO/c13-10-2-1-9(12(14)5-10)7-15-6-8-3-11(16)4-8/h1-2,5,8,11,15-16H,3-4,6-7H2 |
| InChIKey | NXZFZONESCNSCO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.16 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |