C15H23NO3 — CID 107667337
6-ethyl-N,8-dimethoxy-2,2-dimethyl-3,4-dihydrochromen-4-amine (PubChem CID 107667337) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is 6-ethyl-N,8-dimethoxy-2,2-dimethyl-3,4-dihydrochromen-4-amine.
| Compound Name | 6-ethyl-N,8-dimethoxy-2,2-dimethyl-3,4-dihydrochromen-4-amine |
|---|---|
| PubChem CID | 107667337 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 6-ethyl-N,8-dimethoxy-2,2-dimethyl-3,4-dihydrochromen-4-amine |
| SMILES | CCc1cc(OC)c2c(c1)C(NOC)CC(C)(C)O2 |
| InChI | InChI=1S/C15H23NO3/c1-6-10-7-11-12(16-18-5)9-15(2,3)19-14(11)13(8-10)17-4/h7-8,12,16H,6,9H2,1-5H3 |
| InChIKey | LDCSSUZLNWAZED-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|