C15H23NO3 — CID 107667287
5-ethyl-N,7-dimethoxy-2-propyl-2,3-dihydro-1-benzofuran-3-amine (PubChem CID 107667287) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is 5-ethyl-N,7-dimethoxy-2-propyl-2,3-dihydro-1-benzofuran-3-amine.
| Compound Name | 5-ethyl-N,7-dimethoxy-2-propyl-2,3-dihydro-1-benzofuran-3-amine |
|---|---|
| PubChem CID | 107667287 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 5-ethyl-N,7-dimethoxy-2-propyl-2,3-dihydro-1-benzofuran-3-amine |
| SMILES | CCCC1Oc2c(OC)cc(CC)cc2C1NOC |
| InChI | InChI=1S/C15H23NO3/c1-5-7-12-14(16-18-4)11-8-10(6-2)9-13(17-3)15(11)19-12/h8-9,12,14,16H,5-7H2,1-4H3 |
| InChIKey | IRFJNJUFECEUAK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|