C12H16FNO2 — CID 107659849
2-ethyl-7-fluoro-N-methoxy-6-methyl-2,3-dihydro-1-benzofuran-3-amine (PubChem CID 107659849) has the molecular formula C12H16FNO2 and a molecular weight of 225.26 g/mol. Its IUPAC name is 2-ethyl-7-fluoro-N-methoxy-6-methyl-2,3-dihydro-1-benzofuran-3-amine.
| Compound Name | 2-ethyl-7-fluoro-N-methoxy-6-methyl-2,3-dihydro-1-benzofuran-3-amine |
|---|---|
| PubChem CID | 107659849 |
| Molecular Formula | C12H16FNO2 |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 2-ethyl-7-fluoro-N-methoxy-6-methyl-2,3-dihydro-1-benzofuran-3-amine |
| SMILES | CCC1Oc2c(ccc(C)c2F)C1NOC |
| InChI | InChI=1S/C12H16FNO2/c1-4-9-11(14-15-3)8-6-5-7(2)10(13)12(8)16-9/h5-6,9,11,14H,4H2,1-3H3 |
| InChIKey | IYWBEPKIXZADPW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|