C12H14BrClFNO2 — CID 114042734
7-bromo-5-chloro-4-fluoro-N-methoxy-2-propyl-2,3-dihydro-1-benzofuran-3-amine (PubChem CID 114042734) has the molecular formula C12H14BrClFNO2 and a molecular weight of 338.60 g/mol. Its IUPAC name is 7-bromo-5-chloro-4-fluoro-N-methoxy-2-propyl-2,3-dihydro-1-benzofuran-3-amine.
| Compound Name | 7-bromo-5-chloro-4-fluoro-N-methoxy-2-propyl-2,3-dihydro-1-benzofuran-3-amine |
|---|---|
| PubChem CID | 114042734 |
| Molecular Formula | C12H14BrClFNO2 |
| Molecular Weight | 338.60 g/mol |
| Exact Mass | 336.99 |
| IUPAC Name | 7-bromo-5-chloro-4-fluoro-N-methoxy-2-propyl-2,3-dihydro-1-benzofuran-3-amine |
| SMILES | CCCC1Oc2c(Br)cc(Cl)c(F)c2C1NOC |
| InChI | InChI=1S/C12H14BrClFNO2/c1-3-4-8-11(16-17-2)9-10(15)7(14)5-6(13)12(9)18-8/h5,8,11,16H,3-4H2,1-2H3 |
| InChIKey | OIKLECRGGGYAKV-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.60 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|