C14H21NO3 — CID 82462055
7,8-dimethoxy-N,2,2-trimethyl-3,4-dihydrochromen-4-amine (PubChem CID 82462055) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 7,8-dimethoxy-N,2,2-trimethyl-3,4-dihydrochromen-4-amine.
| Compound Name | 7,8-dimethoxy-N,2,2-trimethyl-3,4-dihydrochromen-4-amine |
|---|---|
| PubChem CID | 82462055 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 7,8-dimethoxy-N,2,2-trimethyl-3,4-dihydrochromen-4-amine |
| SMILES | CNC1CC(C)(C)Oc2c1ccc(OC)c2OC |
| InChI | InChI=1S/C14H21NO3/c1-14(2)8-10(15-3)9-6-7-11(16-4)13(17-5)12(9)18-14/h6-7,10,15H,8H2,1-5H3 |
| InChIKey | GTKAQMQBHDUMIO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |