C16H23NO4 — CID 82046856
4,7,8-trimethoxyspiro[3,4-dihydrochromene-2,4'-piperidine] (PubChem CID 82046856) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is 4,7,8-trimethoxyspiro[3,4-dihydrochromene-2,4'-piperidine].
| Compound Name | 4,7,8-trimethoxyspiro[3,4-dihydrochromene-2,4'-piperidine] |
|---|---|
| PubChem CID | 82046856 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 4,7,8-trimethoxyspiro[3,4-dihydrochromene-2,4'-piperidine] |
| SMILES | COc1ccc2c(c1OC)OC1(CCNCC1)CC2OC |
| InChI | InChI=1S/C16H23NO4/c1-18-12-5-4-11-13(19-2)10-16(6-8-17-9-7-16)21-14(11)15(12)20-3/h4-5,13,17H,6-10H2,1-3H3 |
| InChIKey | ICXRRWQPOIQFSK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |