C18H29NO3 — CID 82462059
7,8-dimethoxy-2,2-dimethyl-N-pentyl-3,4-dihydrochromen-4-amine (PubChem CID 82462059) has the molecular formula C18H29NO3 and a molecular weight of 307.43 g/mol. Its IUPAC name is 7,8-dimethoxy-2,2-dimethyl-N-pentyl-3,4-dihydrochromen-4-amine.
| Compound Name | 7,8-dimethoxy-2,2-dimethyl-N-pentyl-3,4-dihydrochromen-4-amine |
|---|---|
| PubChem CID | 82462059 |
| Molecular Formula | C18H29NO3 |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | 7,8-dimethoxy-2,2-dimethyl-N-pentyl-3,4-dihydrochromen-4-amine |
| SMILES | CCCCCNC1CC(C)(C)Oc2c1ccc(OC)c2OC |
| InChI | InChI=1S/C18H29NO3/c1-6-7-8-11-19-14-12-18(2,3)22-16-13(14)9-10-15(20-4)17(16)21-5/h9-10,14,19H,6-8,11-12H2,1-5H3 |
| InChIKey | IHPGORUOECPCTQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|