C15H22BrNO — CID 104945747
(4S)-7-bromo-2-methyl-2-pentyl-3,4-dihydrochromen-4-amine (PubChem CID 104945747) has the molecular formula C15H22BrNO and a molecular weight of 312.25 g/mol. Its IUPAC name is (4S)-7-bromo-2-methyl-2-pentyl-3,4-dihydrochromen-4-amine.
| Compound Name | (4S)-7-bromo-2-methyl-2-pentyl-3,4-dihydrochromen-4-amine |
|---|---|
| PubChem CID | 104945747 |
| Molecular Formula | C15H22BrNO |
| Molecular Weight | 312.25 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | (4S)-7-bromo-2-methyl-2-pentyl-3,4-dihydrochromen-4-amine |
| SMILES | CCCCCC1(C)C[C@H](N)c2ccc(Br)cc2O1 |
| InChI | InChI=1S/C15H22BrNO/c1-3-4-5-8-15(2)10-13(17)12-7-6-11(16)9-14(12)18-15/h6-7,9,13H,3-5,8,10,17H2,1-2H3/t13-,15?/m0/s1 |
| InChIKey | LPXMYKBGJGFQPT-CFMCSPIPSA-N |
| XLogP | 4.57 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.25 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|