C11H14O3 — CID 162926407
(4R)-2,2-dimethyl-3,4-dihydrochromene-4,6-diol (PubChem CID 162926407) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is (4R)-2,2-dimethyl-3,4-dihydrochromene-4,6-diol.
| Compound Name | (4R)-2,2-dimethyl-3,4-dihydrochromene-4,6-diol |
|---|---|
| PubChem CID | 162926407 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | (4R)-2,2-dimethyl-3,4-dihydrochromene-4,6-diol |
| SMILES | CC1(C)C[C@@H](O)c2cc(O)ccc2O1 |
| InChI | InChI=1S/C11H14O3/c1-11(2)6-9(13)8-5-7(12)3-4-10(8)14-11/h3-5,9,12-13H,6H2,1-2H3/t9-/m1/s1 |
| InChIKey | QAIKLSOPCIZDKK-SECBINFHSA-N |
| XLogP | 1.99 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |