C12H16O4 — CID 13123193
7-methoxy-2,2-dimethyl-3,4-dihydrochromene-4,5-diol (PubChem CID 13123193) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is 7-methoxy-2,2-dimethyl-3,4-dihydrochromene-4,5-diol.
| Compound Name | 7-methoxy-2,2-dimethyl-3,4-dihydrochromene-4,5-diol |
|---|---|
| PubChem CID | 13123193 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 7-methoxy-2,2-dimethyl-3,4-dihydrochromene-4,5-diol |
| SMILES | COc1cc(O)c2c(c1)OC(C)(C)CC2O |
| InChI | InChI=1S/C12H16O4/c1-12(2)6-9(14)11-8(13)4-7(15-3)5-10(11)16-12/h4-5,9,13-14H,6H2,1-3H3 |
| InChIKey | JZHVDRLELWBFDY-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |