C15H16O5 — CID 102216544
(10S)-10-hydroxy-5-methoxy-8,8-dimethyl-9,10-dihydropyrano[2,3-f]chromen-2-one (PubChem CID 102216544) has the molecular formula C15H16O5 and a molecular weight of 276.29 g/mol. Its IUPAC name is (10S)-10-hydroxy-5-methoxy-8,8-dimethyl-9,10-dihydropyrano[2,3-f]chromen-2-one.
| Compound Name | (10S)-10-hydroxy-5-methoxy-8,8-dimethyl-9,10-dihydropyrano[2,3-f]chromen-2-one |
|---|---|
| PubChem CID | 102216544 |
| Molecular Formula | C15H16O5 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | (10S)-10-hydroxy-5-methoxy-8,8-dimethyl-9,10-dihydropyrano[2,3-f]chromen-2-one |
| SMILES | COc1cc2c(c3oc(=O)ccc13)[C@@H](O)CC(C)(C)O2 |
| InChI | InChI=1S/C15H16O5/c1-15(2)7-9(16)13-11(20-15)6-10(18-3)8-4-5-12(17)19-14(8)13/h4-6,9,16H,7H2,1-3H3/t9-/m0/s1 |
| InChIKey | QJCFOCITELFVGJ-VIFPVBQESA-N |
| XLogP | 2.40 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|