C19H18O5 — CID 12039177
(4S)-4-hydroxy-5-methoxy-2,2-dimethyl-3,4-dihydropyrano[3,2-b]xanthen-6-one (PubChem CID 12039177) has the molecular formula C19H18O5 and a molecular weight of 326.35 g/mol. Its IUPAC name is (4S)-4-hydroxy-5-methoxy-2,2-dimethyl-3,4-dihydropyrano[3,2-b]xanthen-6-one.
| Compound Name | (4S)-4-hydroxy-5-methoxy-2,2-dimethyl-3,4-dihydropyrano[3,2-b]xanthen-6-one |
|---|---|
| PubChem CID | 12039177 |
| Molecular Formula | C19H18O5 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | (4S)-4-hydroxy-5-methoxy-2,2-dimethyl-3,4-dihydropyrano[3,2-b]xanthen-6-one |
| SMILES | COc1c2c(cc3oc4ccccc4c(=O)c13)OC(C)(C)C[C@@H]2O |
| InChI | InChI=1S/C19H18O5/c1-19(2)9-11(20)15-14(24-19)8-13-16(18(15)22-3)17(21)10-6-4-5-7-12(10)23-13/h4-8,11,20H,9H2,1-3H3/t11-/m0/s1 |
| InChIKey | GAIJXXMCQJFKHJ-NSHDSACASA-N |
| XLogP | 3.55 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|