C20H21NO5 — CID 21125486
1,2-dihydroxy-6-methoxy-3,3,12-trimethyl-1,2-dihydropyrano[2,3-c]acridin-7-one (PubChem CID 21125486) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is 1,2-dihydroxy-6-methoxy-3,3,12-trimethyl-1,2-dihydropyrano[2,3-c]acridin-7-one.
| Compound Name | 1,2-dihydroxy-6-methoxy-3,3,12-trimethyl-1,2-dihydropyrano[2,3-c]acridin-7-one |
|---|---|
| PubChem CID | 21125486 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 1,2-dihydroxy-6-methoxy-3,3,12-trimethyl-1,2-dihydropyrano[2,3-c]acridin-7-one |
| SMILES | COc1cc2c(c3c1c(=O)c1ccccc1n3C)C(O)C(O)C(C)(C)O2 |
| InChI | InChI=1S/C20H21NO5/c1-20(2)19(24)18(23)15-13(26-20)9-12(25-4)14-16(15)21(3)11-8-6-5-7-10(11)17(14)22/h5-9,18-19,23-24H,1-4H3 |
| InChIKey | VMOMUKQKOCLINI-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|