C20H20INO4 — CID 100974610
(1R,2S)-1-hydroxy-2-iodo-6-methoxy-3,3,12-trimethyl-1,2-dihydropyrano[2,3-c]acridin-7-one (PubChem CID 100974610) has the molecular formula C20H20INO4 and a molecular weight of 465.29 g/mol. Its IUPAC name is (1R,2S)-1-hydroxy-2-iodo-6-methoxy-3,3,12-trimethyl-1,2-dihydropyrano[2,3-c]acridin-7-one.
| Compound Name | (1R,2S)-1-hydroxy-2-iodo-6-methoxy-3,3,12-trimethyl-1,2-dihydropyrano[2,3-c]acridin-7-one |
|---|---|
| PubChem CID | 100974610 |
| Molecular Formula | C20H20INO4 |
| Molecular Weight | 465.29 g/mol |
| Exact Mass | 465.04 |
| IUPAC Name | (1R,2S)-1-hydroxy-2-iodo-6-methoxy-3,3,12-trimethyl-1,2-dihydropyrano[2,3-c]acridin-7-one |
| SMILES | COc1cc2c(c3c1c(=O)c1ccccc1n3C)[C@@H](O)[C@H](I)C(C)(C)O2 |
| InChI | InChI=1S/C20H20INO4/c1-20(2)19(21)18(24)15-13(26-20)9-12(25-4)14-16(15)22(3)11-8-6-5-7-10(11)17(14)23/h5-9,18-19,24H,1-4H3/t18-,19+/m1/s1 |
| InChIKey | DJGRTNMRTALIIH-MOPGFXCFSA-N |
| XLogP | 3.71 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.29 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|