C33H29NO6 — CID 131726618
(5-hydroxy-11-methoxy-2,7,7-trimethyl-13-oxo-8-oxa-2-azapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1(14),3,9,11,15,17,19,21-octaen-6-yl) (E)-3-phenylprop-2-enoate (PubChem CID 131726618) has the molecular formula C33H29NO6 and a molecular weight of 535.60 g/mol. Its IUPAC name is (5-hydroxy-11-methoxy-2,7,7-trimethyl-13-oxo-8-oxa-2-azapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1(14),3,9,11,15,17,19,21-octaen-6-yl) (E)-3-phenylprop-2-enoate.
| Compound Name | (5-hydroxy-11-methoxy-2,7,7-trimethyl-13-oxo-8-oxa-2-azapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1(14),3,9,11,15,17,19,21-octaen-6-yl) (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 131726618 |
| Molecular Formula | C33H29NO6 |
| Molecular Weight | 535.60 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | (5-hydroxy-11-methoxy-2,7,7-trimethyl-13-oxo-8-oxa-2-azapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1(14),3,9,11,15,17,19,21-octaen-6-yl) (E)-3-phenylprop-2-enoate |
| SMILES | COc1cc2c(c3c1c(=O)c1c4ccccc4ccc1n3C)C(O)C(OC(=O)/C=C/c1ccccc1)C(C)(C)O2 |
| InChI | InChI=1S/C33H29NO6/c1-33(2)32(39-25(35)17-14-19-10-6-5-7-11-19)31(37)28-24(40-33)18-23(38-4)27-29(28)34(3)22-16-15-20-12-8-9-13-21(20)26(22)30(27)36/h5-18,31-32,37H,1-4H3/b17-14+ |
| InChIKey | FXIJABTYXIWULK-SAPNQHFASA-N |
| XLogP | 5.68 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.60 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|