C33H28N2O8 — CID 44590899
[(5R,6R)-5-hydroxy-11-methoxy-2,7,7-trimethyl-13-oxo-8-oxa-2-azapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(22),3,9,11,14,16,18,20-octaen-6-yl] (E)-3-(4-nitrophenyl)prop-2-enoate (PubChem CID 44590899) has the molecular formula C33H28N2O8 and a molecular weight of 580.59 g/mol. Its IUPAC name is [(5R,6R)-5-hydroxy-11-methoxy-2,7,7-trimethyl-13-oxo-8-oxa-2-azapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(22),3,9,11,14,16,18,20-octaen-6-yl] (E)-3-(4-nitrophenyl)prop-2-enoate.
| Compound Name | [(5R,6R)-5-hydroxy-11-methoxy-2,7,7-trimethyl-13-oxo-8-oxa-2-azapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(22),3,9,11,14,16,18,20-octaen-6-yl] (E)-3-(4-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 44590899 |
| Molecular Formula | C33H28N2O8 |
| Molecular Weight | 580.59 g/mol |
| Exact Mass | 580.18 |
| IUPAC Name | [(5R,6R)-5-hydroxy-11-methoxy-2,7,7-trimethyl-13-oxo-8-oxa-2-azapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(22),3,9,11,14,16,18,20-octaen-6-yl] (E)-3-(4-nitrophenyl)prop-2-enoate |
| SMILES | COc1cc2c(c3c1c(=O)c1cc4ccccc4cc1n3C)[C@@H](O)[C@@H](OC(=O)/C=C/c1ccc([N+](=O)[O-])cc1)C(C)(C)O2 |
| InChI | InChI=1S/C33H28N2O8/c1-33(2)32(42-26(36)14-11-18-9-12-21(13-10-18)35(39)40)31(38)28-25(43-33)17-24(41-4)27-29(28)34(3)23-16-20-8-6-5-7-19(20)15-22(23)30(27)37/h5-17,31-32,38H,1-4H3/b14-11+/t31-,32-/m1/s1 |
| InChIKey | CNIXOBXBXVGLHK-LOCOZNLXSA-N |
| XLogP | 5.59 |
| TPSA | 130.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.59 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|