C21H19NO5S — CID 100974618
(3S,7S)-12-methoxy-8,8,21-trimethyl-5-sulfanylidene-4,6,9-trioxa-21-azapentacyclo[11.8.0.02,10.03,7.015,20]henicosa-1,10,12,15,17,19-hexaen-14-one (PubChem CID 100974618) has the molecular formula C21H19NO5S and a molecular weight of 397.45 g/mol. Its IUPAC name is (3S,7S)-12-methoxy-8,8,21-trimethyl-5-sulfanylidene-4,6,9-trioxa-21-azapentacyclo[11.8.0.02,10.03,7.015,20]henicosa-1,10,12,15,17,19-hexaen-14-one.
| Compound Name | (3S,7S)-12-methoxy-8,8,21-trimethyl-5-sulfanylidene-4,6,9-trioxa-21-azapentacyclo[11.8.0.02,10.03,7.015,20]henicosa-1,10,12,15,17,19-hexaen-14-one |
|---|---|
| PubChem CID | 100974618 |
| Molecular Formula | C21H19NO5S |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | (3S,7S)-12-methoxy-8,8,21-trimethyl-5-sulfanylidene-4,6,9-trioxa-21-azapentacyclo[11.8.0.02,10.03,7.015,20]henicosa-1,10,12,15,17,19-hexaen-14-one |
| SMILES | COc1cc2c(c3c1c(=O)c1ccccc1n3C)[C@@H]1OC(=S)O[C@@H]1C(C)(C)O2 |
| InChI | InChI=1S/C21H19NO5S/c1-21(2)19-18(25-20(28)26-19)15-13(27-21)9-12(24-4)14-16(15)22(3)11-8-6-5-7-10(11)17(14)23/h5-9,18-19H,1-4H3/t18-,19-/m0/s1 |
| InChIKey | QTTAVKHLRMVESW-OALUTQOASA-N |
| XLogP | 3.61 |
| TPSA | 58.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|