C24H19NO6 — CID 11625865
(20R,24R)-15-methoxy-19,19-dimethyl-18,21,23-trioxa-2-azahexacyclo[12.11.0.03,12.04,9.017,25.020,24]pentacosa-1(25),3(12),4,6,8,10,14,16-octaene-13,22-dione (PubChem CID 11625865) has the molecular formula C24H19NO6 and a molecular weight of 417.42 g/mol. Its IUPAC name is (20R,24R)-15-methoxy-19,19-dimethyl-18,21,23-trioxa-2-azahexacyclo[12.11.0.03,12.04,9.017,25.020,24]pentacosa-1(25),3(12),4,6,8,10,14,16-octaene-13,22-dione.
| Compound Name | (20R,24R)-15-methoxy-19,19-dimethyl-18,21,23-trioxa-2-azahexacyclo[12.11.0.03,12.04,9.017,25.020,24]pentacosa-1(25),3(12),4,6,8,10,14,16-octaene-13,22-dione |
|---|---|
| PubChem CID | 11625865 |
| Molecular Formula | C24H19NO6 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | (20R,24R)-15-methoxy-19,19-dimethyl-18,21,23-trioxa-2-azahexacyclo[12.11.0.03,12.04,9.017,25.020,24]pentacosa-1(25),3(12),4,6,8,10,14,16-octaene-13,22-dione |
| SMILES | COc1cc2c(c3[nH]c4c(ccc5ccccc54)c(=O)c13)[C@H]1OC(=O)O[C@H]1C(C)(C)O2 |
| InChI | InChI=1S/C24H19NO6/c1-24(2)22-21(29-23(27)30-22)17-15(31-24)10-14(28-3)16-19(17)25-18-12-7-5-4-6-11(12)8-9-13(18)20(16)26/h4-10,21-22H,1-3H3,(H,25,26)/t21-,22-/m1/s1 |
| InChIKey | XIELCAGGMBKXND-FGZHOGPDSA-N |
| XLogP | 4.59 |
| TPSA | 86.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|