C29H29NO5S — CID 10839201
[(1R,2S)-1-benzylsulfanyl-6-methoxy-3,3,12-trimethyl-7-oxo-1,2-dihydropyrano[2,3-c]acridin-2-yl] acetate (PubChem CID 10839201) has the molecular formula C29H29NO5S and a molecular weight of 503.62 g/mol. Its IUPAC name is [(1R,2S)-1-benzylsulfanyl-6-methoxy-3,3,12-trimethyl-7-oxo-1,2-dihydropyrano[2,3-c]acridin-2-yl] acetate.
| Compound Name | [(1R,2S)-1-benzylsulfanyl-6-methoxy-3,3,12-trimethyl-7-oxo-1,2-dihydropyrano[2,3-c]acridin-2-yl] acetate |
|---|---|
| PubChem CID | 10839201 |
| Molecular Formula | C29H29NO5S |
| Molecular Weight | 503.62 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | [(1R,2S)-1-benzylsulfanyl-6-methoxy-3,3,12-trimethyl-7-oxo-1,2-dihydropyrano[2,3-c]acridin-2-yl] acetate |
| SMILES | COc1cc2c(c3c1c(=O)c1ccccc1n3C)[C@@H](SCc1ccccc1)[C@@H](OC(C)=O)C(C)(C)O2 |
| InChI | InChI=1S/C29H29NO5S/c1-17(31)34-28-27(36-16-18-11-7-6-8-12-18)24-22(35-29(28,2)3)15-21(33-5)23-25(24)30(4)20-14-10-9-13-19(20)26(23)32/h6-15,27-28H,16H2,1-5H3/t27-,28-/m1/s1 |
| InChIKey | SVBJWQQKRBSINC-VSGBNLITSA-N |
| XLogP | 5.78 |
| TPSA | 66.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.62 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|