C23H20O6 — CID 101103558
(8R,9R)-8,9-dihydroxy-11-methoxy-7,7-dimethyl-2,6-dioxapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3,5(10),11,14,16,18,20-octaen-13-one (PubChem CID 101103558) has the molecular formula C23H20O6 and a molecular weight of 392.41 g/mol. Its IUPAC name is (8R,9R)-8,9-dihydroxy-11-methoxy-7,7-dimethyl-2,6-dioxapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3,5(10),11,14,16,18,20-octaen-13-one.
| Compound Name | (8R,9R)-8,9-dihydroxy-11-methoxy-7,7-dimethyl-2,6-dioxapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3,5(10),11,14,16,18,20-octaen-13-one |
|---|---|
| PubChem CID | 101103558 |
| Molecular Formula | C23H20O6 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | (8R,9R)-8,9-dihydroxy-11-methoxy-7,7-dimethyl-2,6-dioxapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3,5(10),11,14,16,18,20-octaen-13-one |
| SMILES | COc1c2c(cc3oc4cc5ccccc5cc4c(=O)c13)OC(C)(C)[C@H](O)[C@@H]2O |
| InChI | InChI=1S/C23H20O6/c1-23(2)22(26)20(25)18-16(29-23)10-15-17(21(18)27-3)19(24)13-8-11-6-4-5-7-12(11)9-14(13)28-15/h4-10,20,22,25-26H,1-3H3/t20-,22-/m1/s1 |
| InChIKey | HGADMLNWOSPCEE-IFMALSPDSA-N |
| XLogP | 3.67 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|