C20H17NO6 — CID 56971453
(1R,2R)-1,2-dihydroxy-6-methoxy-3,3-dimethyl-7-oxo-1,2-dihydropyrano[2,3-c]xanthene-10-carbonitrile (PubChem CID 56971453) has the molecular formula C20H17NO6 and a molecular weight of 367.36 g/mol. Its IUPAC name is (1R,2R)-1,2-dihydroxy-6-methoxy-3,3-dimethyl-7-oxo-1,2-dihydropyrano[2,3-c]xanthene-10-carbonitrile.
| Compound Name | (1R,2R)-1,2-dihydroxy-6-methoxy-3,3-dimethyl-7-oxo-1,2-dihydropyrano[2,3-c]xanthene-10-carbonitrile |
|---|---|
| PubChem CID | 56971453 |
| Molecular Formula | C20H17NO6 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | (1R,2R)-1,2-dihydroxy-6-methoxy-3,3-dimethyl-7-oxo-1,2-dihydropyrano[2,3-c]xanthene-10-carbonitrile |
| SMILES | COc1cc2c(c3oc4cc(C#N)ccc4c(=O)c13)[C@@H](O)[C@@H](O)C(C)(C)O2 |
| InChI | InChI=1S/C20H17NO6/c1-20(2)19(24)17(23)15-13(27-20)7-12(25-3)14-16(22)10-5-4-9(8-21)6-11(10)26-18(14)15/h4-7,17,19,23-24H,1-3H3/t17-,19-/m1/s1 |
| InChIKey | PQUKDMGDFJYGMR-IEBWSBKVSA-N |
| XLogP | 2.39 |
| TPSA | 112.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|