C18H19FO2 — CID 114714156
2-benzyl-2-ethyl-6-fluoro-3,4-dihydrochromen-4-ol (PubChem CID 114714156) has the molecular formula C18H19FO2 and a molecular weight of 286.35 g/mol. Its IUPAC name is 2-benzyl-2-ethyl-6-fluoro-3,4-dihydrochromen-4-ol.
| Compound Name | 2-benzyl-2-ethyl-6-fluoro-3,4-dihydrochromen-4-ol |
|---|---|
| PubChem CID | 114714156 |
| Molecular Formula | C18H19FO2 |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 2-benzyl-2-ethyl-6-fluoro-3,4-dihydrochromen-4-ol |
| SMILES | CCC1(Cc2ccccc2)CC(O)c2cc(F)ccc2O1 |
| InChI | InChI=1S/C18H19FO2/c1-2-18(11-13-6-4-3-5-7-13)12-16(20)15-10-14(19)8-9-17(15)21-18/h3-10,16,20H,2,11-12H2,1H3 |
| InChIKey | UMSIBJYGHQKUBT-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |