C16H24FNO — CID 104944178
(4S)-2-ethyl-6-fluoro-2-(2-methylbutyl)-3,4-dihydrochromen-4-amine (PubChem CID 104944178) has the molecular formula C16H24FNO and a molecular weight of 265.37 g/mol. Its IUPAC name is (4S)-2-ethyl-6-fluoro-2-(2-methylbutyl)-3,4-dihydrochromen-4-amine.
| Compound Name | (4S)-2-ethyl-6-fluoro-2-(2-methylbutyl)-3,4-dihydrochromen-4-amine |
|---|---|
| PubChem CID | 104944178 |
| Molecular Formula | C16H24FNO |
| Molecular Weight | 265.37 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | (4S)-2-ethyl-6-fluoro-2-(2-methylbutyl)-3,4-dihydrochromen-4-amine |
| SMILES | CCC(C)CC1(CC)C[C@H](N)c2cc(F)ccc2O1 |
| InChI | InChI=1S/C16H24FNO/c1-4-11(3)9-16(5-2)10-14(18)13-8-12(17)6-7-15(13)19-16/h6-8,11,14H,4-5,9-10,18H2,1-3H3/t11?,14-,16?/m0/s1 |
| InChIKey | NKLCLDXEZWRPFS-WMEQCIOUSA-N |
| XLogP | 4.19 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.37 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |