C17H27NO2 — CID 104944611
(4S)-2-ethyl-7-methoxy-2-(2-methylbutyl)-3,4-dihydrochromen-4-amine (PubChem CID 104944611) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is (4S)-2-ethyl-7-methoxy-2-(2-methylbutyl)-3,4-dihydrochromen-4-amine.
| Compound Name | (4S)-2-ethyl-7-methoxy-2-(2-methylbutyl)-3,4-dihydrochromen-4-amine |
|---|---|
| PubChem CID | 104944611 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | (4S)-2-ethyl-7-methoxy-2-(2-methylbutyl)-3,4-dihydrochromen-4-amine |
| SMILES | CCC(C)CC1(CC)C[C@H](N)c2ccc(OC)cc2O1 |
| InChI | InChI=1S/C17H27NO2/c1-5-12(3)10-17(6-2)11-15(18)14-8-7-13(19-4)9-16(14)20-17/h7-9,12,15H,5-6,10-11,18H2,1-4H3/t12?,15-,17?/m0/s1 |
| InChIKey | QMXOJQXXPDNBRH-VXKCQOAXSA-N |
| XLogP | 4.06 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |