C18H29NO2 — CID 104980348
(4R)-6-methoxy-2,2-bis(2-methylpropyl)-3,4-dihydrochromen-4-amine (PubChem CID 104980348) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is (4R)-6-methoxy-2,2-bis(2-methylpropyl)-3,4-dihydrochromen-4-amine.
| Compound Name | (4R)-6-methoxy-2,2-bis(2-methylpropyl)-3,4-dihydrochromen-4-amine |
|---|---|
| PubChem CID | 104980348 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | (4R)-6-methoxy-2,2-bis(2-methylpropyl)-3,4-dihydrochromen-4-amine |
| SMILES | COc1ccc2c(c1)[C@H](N)CC(CC(C)C)(CC(C)C)O2 |
| InChI | InChI=1S/C18H29NO2/c1-12(2)9-18(10-13(3)4)11-16(19)15-8-14(20-5)6-7-17(15)21-18/h6-8,12-13,16H,9-11,19H2,1-5H3/t16-/m1/s1 |
| InChIKey | KIZRPANNEUEJRO-MRXNPFEDSA-N |
| XLogP | 4.31 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |