C17H26ClNO — CID 114868304
6-chloro-2,2-bis(2-methylpropyl)-3,4-dihydrochromen-4-amine (PubChem CID 114868304) has the molecular formula C17H26ClNO and a molecular weight of 295.85 g/mol. Its IUPAC name is 6-chloro-2,2-bis(2-methylpropyl)-3,4-dihydrochromen-4-amine.
| Compound Name | 6-chloro-2,2-bis(2-methylpropyl)-3,4-dihydrochromen-4-amine |
|---|---|
| PubChem CID | 114868304 |
| Molecular Formula | C17H26ClNO |
| Molecular Weight | 295.85 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | 6-chloro-2,2-bis(2-methylpropyl)-3,4-dihydrochromen-4-amine |
| SMILES | CC(C)CC1(CC(C)C)CC(N)c2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C17H26ClNO/c1-11(2)8-17(9-12(3)4)10-15(19)14-7-13(18)5-6-16(14)20-17/h5-7,11-12,15H,8-10,19H2,1-4H3 |
| InChIKey | PPSXZHKXTBAEHB-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.85 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |