C14H20O3 — CID 104950510
(4S)-2-(1-methoxyethyl)-2,6-dimethyl-3,4-dihydrochromen-4-ol (PubChem CID 104950510) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (4S)-2-(1-methoxyethyl)-2,6-dimethyl-3,4-dihydrochromen-4-ol.
| Compound Name | (4S)-2-(1-methoxyethyl)-2,6-dimethyl-3,4-dihydrochromen-4-ol |
|---|---|
| PubChem CID | 104950510 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (4S)-2-(1-methoxyethyl)-2,6-dimethyl-3,4-dihydrochromen-4-ol |
| SMILES | COC(C)C1(C)C[C@H](O)c2cc(C)ccc2O1 |
| InChI | InChI=1S/C14H20O3/c1-9-5-6-13-11(7-9)12(15)8-14(3,17-13)10(2)16-4/h5-7,10,12,15H,8H2,1-4H3/t10?,12-,14?/m0/s1 |
| InChIKey | JUYQSYHOCPRUBC-KHJSKFAYSA-N |
| XLogP | 2.60 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |