C14H18O2S — CID 104950482
(4S)-6-methylspiro[3,4-dihydrochromene-2,4'-thiane]-4-ol (PubChem CID 104950482) has the molecular formula C14H18O2S and a molecular weight of 250.36 g/mol. Its IUPAC name is (4S)-6-methylspiro[3,4-dihydrochromene-2,4'-thiane]-4-ol.
| Compound Name | (4S)-6-methylspiro[3,4-dihydrochromene-2,4'-thiane]-4-ol |
|---|---|
| PubChem CID | 104950482 |
| Molecular Formula | C14H18O2S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | (4S)-6-methylspiro[3,4-dihydrochromene-2,4'-thiane]-4-ol |
| SMILES | Cc1ccc2c(c1)[C@@H](O)CC1(CCSCC1)O2 |
| InChI | InChI=1S/C14H18O2S/c1-10-2-3-13-11(8-10)12(15)9-14(16-13)4-6-17-7-5-14/h2-3,8,12,15H,4-7,9H2,1H3/t12-/m0/s1 |
| InChIKey | GGQQOYSMYJTCTR-LBPRGKRZSA-N |
| XLogP | 3.08 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |