C12H13ClO2S — CID 104949137
(4R)-6-chlorospiro[3,4-dihydrochromene-2,3'-thiolane]-4-ol (PubChem CID 104949137) has the molecular formula C12H13ClO2S and a molecular weight of 256.75 g/mol. Its IUPAC name is (4R)-6-chlorospiro[3,4-dihydrochromene-2,3'-thiolane]-4-ol.
| Compound Name | (4R)-6-chlorospiro[3,4-dihydrochromene-2,3'-thiolane]-4-ol |
|---|---|
| PubChem CID | 104949137 |
| Molecular Formula | C12H13ClO2S |
| Molecular Weight | 256.75 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | (4R)-6-chlorospiro[3,4-dihydrochromene-2,3'-thiolane]-4-ol |
| SMILES | O[C@@H]1CC2(CCSC2)Oc2ccc(Cl)cc21 |
| InChI | InChI=1S/C12H13ClO2S/c13-8-1-2-11-9(5-8)10(14)6-12(15-11)3-4-16-7-12/h1-2,5,10,14H,3-4,6-7H2/t10-,12?/m1/s1 |
| InChIKey | GYTDLIRNESILSN-RWANSRKNSA-N |
| XLogP | 3.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.75 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |