About (4S)-3'-methoxy-6-methylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-ol
(4S)-3'-methoxy-6-methylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-ol (PubChem CID 106825056) has the molecular formula C14H18O3
and a molecular weight of 234.30 g/mol. Its IUPAC name is (4S)-3'-methoxy-6-methylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-ol.
Molecular Properties
| Compound Name | (4S)-3'-methoxy-6-methylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-ol |
| PubChem CID | 106825056 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (4S)-3'-methoxy-6-methylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-ol |
| SMILES | COC1CC2(C1)C[C@H](O)c1cc(C)ccc1O2 |
| InChI | InChI=1S/C14H18O3/c1-9-3-4-13-11(5-9)12(15)8-14(17-13)6-10(7-14)16-2/h3-5,10,12,15H,6-8H2,1-2H3/t10?,12-,14?/m0/s1 |
| InChIKey | QHKACUBEWWZLNV-KHJSKFAYSA-N |
| XLogP | 2.36 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S)-3'-methoxy-6-methylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-3'-methoxy-6-methylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-ol?
The IUPAC name of (4S)-3'-methoxy-6-methylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-ol (CID 106825056) is (4S)-3'-methoxy-6-methylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-ol.
What is the SMILES notation for (4S)-3'-methoxy-6-methylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-ol?
The canonical SMILES for (4S)-3'-methoxy-6-methylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-ol is COC1CC2(C1)C[C@H](O)c1cc(C)ccc1O2.
What is the InChIKey of (4S)-3'-methoxy-6-methylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-ol?
The InChIKey is QHKACUBEWWZLNV-KHJSKFAYSA-N. The full InChI is InChI=1S/C14H18O3/c1-9-3-4-13-11(5-9)12(15)8-14(17-13)6-10(7-14)16-2/h3-5,10,12,15H,6-8H2,1-2H3/t10?,12-,14?/m0/s1.
What are the key properties of (4S)-3'-methoxy-6-methylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-ol?
(4S)-3'-methoxy-6-methylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-ol has a molecular weight of 234.30 g/mol, XLogP of 2.36, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-3'-methoxy-6-methylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-ol is sourced from PubChem (CID 106825056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).