C14H20O2 — CID 114715147
2,6-dimethyl-2-propyl-3,4-dihydrochromen-4-ol (PubChem CID 114715147) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is 2,6-dimethyl-2-propyl-3,4-dihydrochromen-4-ol.
| Compound Name | 2,6-dimethyl-2-propyl-3,4-dihydrochromen-4-ol |
|---|---|
| PubChem CID | 114715147 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 2,6-dimethyl-2-propyl-3,4-dihydrochromen-4-ol |
| SMILES | CCCC1(C)CC(O)c2cc(C)ccc2O1 |
| InChI | InChI=1S/C14H20O2/c1-4-7-14(3)9-12(15)11-8-10(2)5-6-13(11)16-14/h5-6,8,12,15H,4,7,9H2,1-3H3 |
| InChIKey | ATBPZZBIGSCXAD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |