C17H25ClO2 — CID 104949004
(4S)-6-chloro-2-heptyl-2-methyl-3,4-dihydrochromen-4-ol (PubChem CID 104949004) has the molecular formula C17H25ClO2 and a molecular weight of 296.84 g/mol. Its IUPAC name is (4S)-6-chloro-2-heptyl-2-methyl-3,4-dihydrochromen-4-ol.
| Compound Name | (4S)-6-chloro-2-heptyl-2-methyl-3,4-dihydrochromen-4-ol |
|---|---|
| PubChem CID | 104949004 |
| Molecular Formula | C17H25ClO2 |
| Molecular Weight | 296.84 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | (4S)-6-chloro-2-heptyl-2-methyl-3,4-dihydrochromen-4-ol |
| SMILES | CCCCCCCC1(C)C[C@H](O)c2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C17H25ClO2/c1-3-4-5-6-7-10-17(2)12-15(19)14-11-13(18)8-9-16(14)20-17/h8-9,11,15,19H,3-7,10,12H2,1-2H3/t15-,17?/m0/s1 |
| InChIKey | FMUMNAZHWMYLDQ-MYJWUSKBSA-N |
| XLogP | 5.28 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.84 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|